C11H8BrNO4 — CID 46206658
(3R)-1-(4-bromophenyl)-2,5-dioxopyrrolidine-3-carboxylic acid (PubChem CID 46206658) has the molecular formula C11H8BrNO4 and a molecular weight of 298.09 g/mol. Its IUPAC name is (3R)-1-(4-bromophenyl)-2,5-dioxopyrrolidine-3-carboxylic acid.
| Compound Name | (3R)-1-(4-bromophenyl)-2,5-dioxopyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 46206658 |
| Molecular Formula | C11H8BrNO4 |
| Molecular Weight | 298.09 g/mol |
| Exact Mass | 296.96 |
| IUPAC Name | (3R)-1-(4-bromophenyl)-2,5-dioxopyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CC(=O)N(c2ccc(Br)cc2)C1=O |
| InChI | InChI=1S/C11H8BrNO4/c12-6-1-3-7(4-2-6)13-9(14)5-8(10(13)15)11(16)17/h1-4,8H,5H2,(H,16,17)/t8-/m1/s1 |
| InChIKey | UUTFAFUYOSGSBW-MRVPVSSYSA-N |
| XLogP | 1.41 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.09 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|