C14H14BrNO3 — CID 71725303
2-[(3S)-1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-2-methylpropanal (PubChem CID 71725303) has the molecular formula C14H14BrNO3 and a molecular weight of 324.17 g/mol. Its IUPAC name is 2-[(3S)-1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-2-methylpropanal.
| Compound Name | 2-[(3S)-1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-2-methylpropanal |
|---|---|
| PubChem CID | 71725303 |
| Molecular Formula | C14H14BrNO3 |
| Molecular Weight | 324.17 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | 2-[(3S)-1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-2-methylpropanal |
| SMILES | CC(C)(C=O)[C@@H]1CC(=O)N(c2ccc(Br)cc2)C1=O |
| InChI | InChI=1S/C14H14BrNO3/c1-14(2,8-17)11-7-12(18)16(13(11)19)10-5-3-9(15)4-6-10/h3-6,8,11H,7H2,1-2H3/t11-/m1/s1 |
| InChIKey | BKMMLKCDXRFKIB-LLVKDONJSA-N |
| XLogP | 2.55 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.17 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|