C20H15BrN2O4 — CID 139260195
methyl (2S)-2-[(3R)-1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-2-isocyano-2-phenylacetate (PubChem CID 139260195) has the molecular formula C20H15BrN2O4 and a molecular weight of 427.25 g/mol. Its IUPAC name is methyl (2S)-2-[(3R)-1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-2-isocyano-2-phenylacetate.
| Compound Name | methyl (2S)-2-[(3R)-1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-2-isocyano-2-phenylacetate |
|---|---|
| PubChem CID | 139260195 |
| Molecular Formula | C20H15BrN2O4 |
| Molecular Weight | 427.25 g/mol |
| Exact Mass | 426.02 |
| IUPAC Name | methyl (2S)-2-[(3R)-1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-2-isocyano-2-phenylacetate |
| SMILES | [C-]#[N+][C@](C(=O)OC)(c1ccccc1)[C@H]1CC(=O)N(c2ccc(Br)cc2)C1=O |
| InChI | InChI=1S/C20H15BrN2O4/c1-22-20(19(26)27-2,13-6-4-3-5-7-13)16-12-17(24)23(18(16)25)15-10-8-14(21)9-11-15/h3-11,16H,12H2,2H3/t16-,20+/m0/s1 |
| InChIKey | JIHXIZUNROCTJI-OXJNMPFZSA-N |
| XLogP | 3.32 |
| TPSA | 68.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.25 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|