C21H18N2O4 — CID 139260156
ethyl (2S)-2-cyano-2-[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]-2-phenylacetate (PubChem CID 139260156) has the molecular formula C21H18N2O4 and a molecular weight of 362.39 g/mol. Its IUPAC name is ethyl (2S)-2-cyano-2-[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]-2-phenylacetate.
| Compound Name | ethyl (2S)-2-cyano-2-[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]-2-phenylacetate |
|---|---|
| PubChem CID | 139260156 |
| Molecular Formula | C21H18N2O4 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | ethyl (2S)-2-cyano-2-[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]-2-phenylacetate |
| SMILES | CCOC(=O)[C@](C#N)(c1ccccc1)[C@@H]1CC(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C21H18N2O4/c1-2-27-20(26)21(14-22,15-9-5-3-6-10-15)17-13-18(24)23(19(17)25)16-11-7-4-8-12-16/h3-12,17H,2,13H2,1H3/t17-,21-/m1/s1 |
| InChIKey | RGRDXDSJVXZOGB-DYESRHJHSA-N |
| XLogP | 2.59 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|