C22H19N3O6 — CID 139260181
ethyl (2S)-2-cyano-2-(4-methylphenyl)-2-[(3S)-1-(4-nitrophenyl)-2,5-dioxopyrrolidin-3-yl]acetate (PubChem CID 139260181) has the molecular formula C22H19N3O6 and a molecular weight of 421.41 g/mol. Its IUPAC name is ethyl (2S)-2-cyano-2-(4-methylphenyl)-2-[(3S)-1-(4-nitrophenyl)-2,5-dioxopyrrolidin-3-yl]acetate.
| Compound Name | ethyl (2S)-2-cyano-2-(4-methylphenyl)-2-[(3S)-1-(4-nitrophenyl)-2,5-dioxopyrrolidin-3-yl]acetate |
|---|---|
| PubChem CID | 139260181 |
| Molecular Formula | C22H19N3O6 |
| Molecular Weight | 421.41 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | ethyl (2S)-2-cyano-2-(4-methylphenyl)-2-[(3S)-1-(4-nitrophenyl)-2,5-dioxopyrrolidin-3-yl]acetate |
| SMILES | CCOC(=O)[C@](C#N)(c1ccc(C)cc1)[C@@H]1CC(=O)N(c2ccc([N+](=O)[O-])cc2)C1=O |
| InChI | InChI=1S/C22H19N3O6/c1-3-31-21(28)22(13-23,15-6-4-14(2)5-7-15)18-12-19(26)24(20(18)27)16-8-10-17(11-9-16)25(29)30/h4-11,18H,3,12H2,1-2H3/t18-,22-/m1/s1 |
| InChIKey | JWRJEEXPQBEGJG-XMSQKQJNSA-N |
| XLogP | 2.81 |
| TPSA | 130.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.41 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|