C23H14N6O8 — CID 98143653
2-[(3R)-1-(4-nitrophenyl)-2,5-dioxopyrrolidin-3-yl]-2-[(3S)-1-(4-nitrophenyl)-2,5-dioxopyrrolidin-3-yl]propanedinitrile (PubChem CID 98143653) has the molecular formula C23H14N6O8 and a molecular weight of 502.40 g/mol. Its IUPAC name is 2-[(3R)-1-(4-nitrophenyl)-2,5-dioxopyrrolidin-3-yl]-2-[(3S)-1-(4-nitrophenyl)-2,5-dioxopyrrolidin-3-yl]propanedinitrile.
| Compound Name | 2-[(3R)-1-(4-nitrophenyl)-2,5-dioxopyrrolidin-3-yl]-2-[(3S)-1-(4-nitrophenyl)-2,5-dioxopyrrolidin-3-yl]propanedinitrile |
|---|---|
| PubChem CID | 98143653 |
| Molecular Formula | C23H14N6O8 |
| Molecular Weight | 502.40 g/mol |
| Exact Mass | 502.09 |
| IUPAC Name | 2-[(3R)-1-(4-nitrophenyl)-2,5-dioxopyrrolidin-3-yl]-2-[(3S)-1-(4-nitrophenyl)-2,5-dioxopyrrolidin-3-yl]propanedinitrile |
| SMILES | N#CC(C#N)([C@@H]1CC(=O)N(c2ccc([N+](=O)[O-])cc2)C1=O)[C@H]1CC(=O)N(c2ccc([N+](=O)[O-])cc2)C1=O |
| InChI | InChI=1S/C23H14N6O8/c24-11-23(12-25,17-9-19(30)26(21(17)32)13-1-5-15(6-2-13)28(34)35)18-10-20(31)27(22(18)33)14-3-7-16(8-4-14)29(36)37/h1-8,17-18H,9-10H2/t17-,18+ |
| InChIKey | SEUSGXXKUFZBGY-HDICACEKSA-N |
| XLogP | 2.00 |
| TPSA | 208.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.40 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|