C29H24N4O10 — CID 95241311
ethyl (2S,6R,8R,12S)-1,14-dimethyl-4,10-bis(4-nitrophenyl)-3,5,9,11-tetraoxo-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-13-carboxylate (PubChem CID 95241311) has the molecular formula C29H24N4O10 and a molecular weight of 588.53 g/mol. Its IUPAC name is ethyl (2S,6R,8R,12S)-1,14-dimethyl-4,10-bis(4-nitrophenyl)-3,5,9,11-tetraoxo-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-13-carboxylate.
| Compound Name | ethyl (2S,6R,8R,12S)-1,14-dimethyl-4,10-bis(4-nitrophenyl)-3,5,9,11-tetraoxo-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-13-carboxylate |
|---|---|
| PubChem CID | 95241311 |
| Molecular Formula | C29H24N4O10 |
| Molecular Weight | 588.53 g/mol |
| Exact Mass | 588.15 |
| IUPAC Name | ethyl (2S,6R,8R,12S)-1,14-dimethyl-4,10-bis(4-nitrophenyl)-3,5,9,11-tetraoxo-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-13-carboxylate |
| SMILES | CCOC(=O)C1=C(C)C2[C@H]3C(=O)N(c4ccc([N+](=O)[O-])cc4)C(=O)[C@@H]3C1(C)[C@H]1C(=O)N(c3ccc([N+](=O)[O-])cc3)C(=O)[C@H]21 |
| InChI | InChI=1S/C29H24N4O10/c1-4-43-28(38)21-13(2)18-19-22(26(36)30(24(19)34)14-5-9-16(10-6-14)32(39)40)29(21,3)23-20(18)25(35)31(27(23)37)15-7-11-17(12-8-15)33(41)42/h5-12,18-20,22-23H,4H2,1-3H3/t18?,19-,20-,22-,23-,29?/m1/s1 |
| InChIKey | WIYUYDWXDYFMNR-YGJMBROUSA-N |
| XLogP | 2.94 |
| TPSA | 187.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.53 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|