C33H30N2O10 — CID 98456039
ethyl (2R,6S,8R,12S)-4,10-bis(4-methoxycarbonylphenyl)-1,14-dimethyl-3,5,9,11-tetraoxo-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-13-carboxylate (PubChem CID 98456039) has the molecular formula C33H30N2O10 and a molecular weight of 614.61 g/mol. Its IUPAC name is ethyl (2R,6S,8R,12S)-4,10-bis(4-methoxycarbonylphenyl)-1,14-dimethyl-3,5,9,11-tetraoxo-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-13-carboxylate.
| Compound Name | ethyl (2R,6S,8R,12S)-4,10-bis(4-methoxycarbonylphenyl)-1,14-dimethyl-3,5,9,11-tetraoxo-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-13-carboxylate |
|---|---|
| PubChem CID | 98456039 |
| Molecular Formula | C33H30N2O10 |
| Molecular Weight | 614.61 g/mol |
| Exact Mass | 614.19 |
| IUPAC Name | ethyl (2R,6S,8R,12S)-4,10-bis(4-methoxycarbonylphenyl)-1,14-dimethyl-3,5,9,11-tetraoxo-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-13-carboxylate |
| SMILES | CCOC(=O)C1=C(C)C2[C@H]3C(=O)N(c4ccc(C(=O)OC)cc4)C(=O)[C@@H]3C1(C)[C@@H]1C(=O)N(c3ccc(C(=O)OC)cc3)C(=O)[C@@H]21 |
| InChI | InChI=1S/C33H30N2O10/c1-6-45-32(42)23-15(2)20-21-24(28(38)34(26(21)36)18-11-7-16(8-12-18)30(40)43-4)33(23,3)25-22(20)27(37)35(29(25)39)19-13-9-17(10-14-19)31(41)44-5/h7-14,20-22,24-25H,6H2,1-5H3/t20?,21-,22+,24-,25+,33? |
| InChIKey | DIKARTHLYAVYHG-ZQJRZEPCSA-N |
| XLogP | 2.70 |
| TPSA | 153.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.61 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|