C33H30N2O10 — CID 163037713
ethyl (6S,8R,12R)-4,10-bis(4-acetyloxyphenyl)-1,14-dimethyl-3,5,9,11-tetraoxo-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-13-carboxylate (PubChem CID 163037713) has the molecular formula C33H30N2O10 and a molecular weight of 614.61 g/mol. Its IUPAC name is ethyl (6S,8R,12R)-4,10-bis(4-acetyloxyphenyl)-1,14-dimethyl-3,5,9,11-tetraoxo-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-13-carboxylate.
| Compound Name | ethyl (6S,8R,12R)-4,10-bis(4-acetyloxyphenyl)-1,14-dimethyl-3,5,9,11-tetraoxo-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-13-carboxylate |
|---|---|
| PubChem CID | 163037713 |
| Molecular Formula | C33H30N2O10 |
| Molecular Weight | 614.61 g/mol |
| Exact Mass | 614.19 |
| IUPAC Name | ethyl (6S,8R,12R)-4,10-bis(4-acetyloxyphenyl)-1,14-dimethyl-3,5,9,11-tetraoxo-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-13-carboxylate |
| SMILES | CCOC(=O)C1=C(C)C2[C@@H]3C(=O)N(c4ccc(OC(C)=O)cc4)C(=O)C3C1(C)[C@@H]1C(=O)N(c3ccc(OC(C)=O)cc3)C(=O)[C@H]21 |
| InChI | InChI=1S/C33H30N2O10/c1-6-43-32(42)25-15(2)22-23-26(30(40)34(28(23)38)18-7-11-20(12-8-18)44-16(3)36)33(25,5)27-24(22)29(39)35(31(27)41)19-9-13-21(14-10-19)45-17(4)37/h7-14,22-24,26-27H,6H2,1-5H3/t22?,23-,24+,26+,27?,33?/m1/s1 |
| InChIKey | KZOLWLNXXNOVAL-JGLBTMNYSA-N |
| XLogP | 2.98 |
| TPSA | 153.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.61 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|