C33H34N2O8 — CID 11871594
ethyl (2R,6S,8R,12R)-4,10-bis(4-ethoxyphenyl)-1,14-dimethyl-3,5,9,11-tetraoxo-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-13-carboxylate (PubChem CID 11871594) has the molecular formula C33H34N2O8 and a molecular weight of 586.64 g/mol. Its IUPAC name is ethyl (2R,6S,8R,12R)-4,10-bis(4-ethoxyphenyl)-1,14-dimethyl-3,5,9,11-tetraoxo-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-13-carboxylate.
| Compound Name | ethyl (2R,6S,8R,12R)-4,10-bis(4-ethoxyphenyl)-1,14-dimethyl-3,5,9,11-tetraoxo-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-13-carboxylate |
|---|---|
| PubChem CID | 11871594 |
| Molecular Formula | C33H34N2O8 |
| Molecular Weight | 586.64 g/mol |
| Exact Mass | 586.23 |
| IUPAC Name | ethyl (2R,6S,8R,12R)-4,10-bis(4-ethoxyphenyl)-1,14-dimethyl-3,5,9,11-tetraoxo-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-13-carboxylate |
| SMILES | CCOC(=O)C1=C(C)C2[C@H]3C(=O)N(c4ccc(OCC)cc4)C(=O)[C@H]3C1(C)[C@@H]1C(=O)N(c3ccc(OCC)cc3)C(=O)[C@@H]21 |
| InChI | InChI=1S/C33H34N2O8/c1-6-41-20-13-9-18(10-14-20)34-28(36)23-22-17(4)25(32(40)43-8-3)33(5,26(23)30(34)38)27-24(22)29(37)35(31(27)39)19-11-15-21(16-12-19)42-7-2/h9-16,22-24,26-27H,6-8H2,1-5H3/t22?,23-,24+,26-,27-,33?/m0/s1 |
| InChIKey | MHVMSWYLOIBQDP-QUSKXDSLSA-N |
| XLogP | 3.92 |
| TPSA | 119.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.64 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|