C37H42N2O8 — CID 97182383
ethyl (2R,6R,8R,12R)-4,10-bis(4-butoxyphenyl)-1,14-dimethyl-3,5,9,11-tetraoxo-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-13-carboxylate (PubChem CID 97182383) has the molecular formula C37H42N2O8 and a molecular weight of 642.75 g/mol. Its IUPAC name is ethyl (2R,6R,8R,12R)-4,10-bis(4-butoxyphenyl)-1,14-dimethyl-3,5,9,11-tetraoxo-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-13-carboxylate.
| Compound Name | ethyl (2R,6R,8R,12R)-4,10-bis(4-butoxyphenyl)-1,14-dimethyl-3,5,9,11-tetraoxo-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-13-carboxylate |
|---|---|
| PubChem CID | 97182383 |
| Molecular Formula | C37H42N2O8 |
| Molecular Weight | 642.75 g/mol |
| Exact Mass | 642.29 |
| IUPAC Name | ethyl (2R,6R,8R,12R)-4,10-bis(4-butoxyphenyl)-1,14-dimethyl-3,5,9,11-tetraoxo-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-13-carboxylate |
| SMILES | CCCCOc1ccc(N2C(=O)[C@@H]3C4C(C)=C(C(=O)OCC)C(C)([C@@H]3C2=O)[C@@H]2C(=O)N(c3ccc(OCCCC)cc3)C(=O)[C@H]42)cc1 |
| InChI | InChI=1S/C37H42N2O8/c1-6-9-19-46-24-15-11-22(12-16-24)38-32(40)27-26-21(4)29(36(44)45-8-3)37(5,30(27)34(38)42)31-28(26)33(41)39(35(31)43)23-13-17-25(18-14-23)47-20-10-7-2/h11-18,26-28,30-31H,6-10,19-20H2,1-5H3/t26?,27-,28-,30+,31+,37?/m1/s1 |
| InChIKey | CCUJUXMAMRIMBC-XBMSCXGASA-N |
| XLogP | 5.49 |
| TPSA | 119.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.75 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|