C23H22N2O5 — CID 139260179
ethyl (2S)-2-cyano-2-[(3S)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-2-(4-methylphenyl)acetate (PubChem CID 139260179) has the molecular formula C23H22N2O5 and a molecular weight of 406.44 g/mol. Its IUPAC name is ethyl (2S)-2-cyano-2-[(3S)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-2-(4-methylphenyl)acetate.
| Compound Name | ethyl (2S)-2-cyano-2-[(3S)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-2-(4-methylphenyl)acetate |
|---|---|
| PubChem CID | 139260179 |
| Molecular Formula | C23H22N2O5 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | ethyl (2S)-2-cyano-2-[(3S)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-2-(4-methylphenyl)acetate |
| SMILES | CCOC(=O)[C@](C#N)(c1ccc(C)cc1)[C@@H]1CC(=O)N(c2ccc(OC)cc2)C1=O |
| InChI | InChI=1S/C23H22N2O5/c1-4-30-22(28)23(14-24,16-7-5-15(2)6-8-16)19-13-20(26)25(21(19)27)17-9-11-18(29-3)12-10-17/h5-12,19H,4,13H2,1-3H3/t19-,23-/m1/s1 |
| InChIKey | HFEKUKMPYGSPMG-AUSIDOKSSA-N |
| XLogP | 2.91 |
| TPSA | 96.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|