C21H29NO3 — CID 139259707
2-[(3R)-2,5-dioxo-1-phenylpyrrolidin-3-yl]-2-methyldecanal (PubChem CID 139259707) has the molecular formula C21H29NO3 and a molecular weight of 343.47 g/mol. Its IUPAC name is 2-[(3R)-2,5-dioxo-1-phenylpyrrolidin-3-yl]-2-methyldecanal.
| Compound Name | 2-[(3R)-2,5-dioxo-1-phenylpyrrolidin-3-yl]-2-methyldecanal |
|---|---|
| PubChem CID | 139259707 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | 2-[(3R)-2,5-dioxo-1-phenylpyrrolidin-3-yl]-2-methyldecanal |
| SMILES | CCCCCCCCC(C)(C=O)[C@H]1CC(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C21H29NO3/c1-3-4-5-6-7-11-14-21(2,16-23)18-15-19(24)22(20(18)25)17-12-9-8-10-13-17/h8-10,12-13,16,18H,3-7,11,14-15H2,1-2H3/t18-,21?/m0/s1 |
| InChIKey | OMHNSZUVXAPCKR-YMXDCFFPSA-N |
| XLogP | 4.52 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|