C23H33NO3 — CID 139259704
2-[(3R)-1-benzyl-2,5-dioxopyrrolidin-3-yl]-2-ethyldecanal (PubChem CID 139259704) has the molecular formula C23H33NO3 and a molecular weight of 371.52 g/mol. Its IUPAC name is 2-[(3R)-1-benzyl-2,5-dioxopyrrolidin-3-yl]-2-ethyldecanal.
| Compound Name | 2-[(3R)-1-benzyl-2,5-dioxopyrrolidin-3-yl]-2-ethyldecanal |
|---|---|
| PubChem CID | 139259704 |
| Molecular Formula | C23H33NO3 |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.25 |
| IUPAC Name | 2-[(3R)-1-benzyl-2,5-dioxopyrrolidin-3-yl]-2-ethyldecanal |
| SMILES | CCCCCCCCC(C=O)(CC)[C@H]1CC(=O)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C23H33NO3/c1-3-5-6-7-8-12-15-23(4-2,18-25)20-16-21(26)24(22(20)27)17-19-13-10-9-11-14-19/h9-11,13-14,18,20H,3-8,12,15-17H2,1-2H3/t20-,23?/m0/s1 |
| InChIKey | JKEYNAFOJFNUGJ-AJZOCDQUSA-N |
| XLogP | 4.91 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|