C24H25NO5 — CID 139259633
ethyl 2-benzyl-2-(1-benzyl-2,5-dioxopyrrolidin-3-yl)-3-oxobutanoate (PubChem CID 139259633) has the molecular formula C24H25NO5 and a molecular weight of 407.47 g/mol. Its IUPAC name is ethyl 2-benzyl-2-(1-benzyl-2,5-dioxopyrrolidin-3-yl)-3-oxobutanoate.
| Compound Name | ethyl 2-benzyl-2-(1-benzyl-2,5-dioxopyrrolidin-3-yl)-3-oxobutanoate |
|---|---|
| PubChem CID | 139259633 |
| Molecular Formula | C24H25NO5 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | ethyl 2-benzyl-2-(1-benzyl-2,5-dioxopyrrolidin-3-yl)-3-oxobutanoate |
| SMILES | CCOC(=O)C(Cc1ccccc1)(C(C)=O)C1CC(=O)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C24H25NO5/c1-3-30-23(29)24(17(2)26,15-18-10-6-4-7-11-18)20-14-21(27)25(22(20)28)16-19-12-8-5-9-13-19/h4-13,20H,3,14-16H2,1-2H3 |
| InChIKey | WMLODEFUBCODQF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|