C20H27NO3 — CID 139259755
1-benzyl-3-(5-oxononan-4-yl)pyrrolidine-2,5-dione (PubChem CID 139259755) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is 1-benzyl-3-(5-oxononan-4-yl)pyrrolidine-2,5-dione.
| Compound Name | 1-benzyl-3-(5-oxononan-4-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 139259755 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 1-benzyl-3-(5-oxononan-4-yl)pyrrolidine-2,5-dione |
| SMILES | CCCCC(=O)C(CCC)C1CC(=O)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C20H27NO3/c1-3-5-12-18(22)16(9-4-2)17-13-19(23)21(20(17)24)14-15-10-7-6-8-11-15/h6-8,10-11,16-17H,3-5,9,12-14H2,1-2H3 |
| InChIKey | HLQVFKDESYHBCI-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|