C18H23N2O4- — CID 2006792
N-[(3S)-1-benzyl-2,5-dioxopyrrolidin-3-yl]-N-oxidoheptanamide (PubChem CID 2006792) has the molecular formula C18H23N2O4- and a molecular weight of 331.39 g/mol. Its IUPAC name is N-[(3S)-1-benzyl-2,5-dioxopyrrolidin-3-yl]-N-oxidoheptanamide.
| Compound Name | N-[(3S)-1-benzyl-2,5-dioxopyrrolidin-3-yl]-N-oxidoheptanamide |
|---|---|
| PubChem CID | 2006792 |
| Molecular Formula | C18H23N2O4- |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | N-[(3S)-1-benzyl-2,5-dioxopyrrolidin-3-yl]-N-oxidoheptanamide |
| SMILES | CCCCCCC(=O)N([O-])[C@H]1CC(=O)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C18H23N2O4/c1-2-3-4-8-11-16(21)20(24)15-12-17(22)19(18(15)23)13-14-9-6-5-7-10-14/h5-7,9-10,15H,2-4,8,11-13H2,1H3/q-1/t15-/m0/s1 |
| InChIKey | UCJLPTXMAKYGKY-HNNXBMFYSA-N |
| XLogP | 2.61 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|