C21H19NO4 — CID 139260110
(3R)-1-benzyl-3-(1,3-dioxo-1-phenylbutan-2-yl)pyrrolidine-2,5-dione (PubChem CID 139260110) has the molecular formula C21H19NO4 and a molecular weight of 349.39 g/mol. Its IUPAC name is (3R)-1-benzyl-3-(1,3-dioxo-1-phenylbutan-2-yl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-1-benzyl-3-(1,3-dioxo-1-phenylbutan-2-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 139260110 |
| Molecular Formula | C21H19NO4 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | (3R)-1-benzyl-3-(1,3-dioxo-1-phenylbutan-2-yl)pyrrolidine-2,5-dione |
| SMILES | CC(=O)C(C(=O)c1ccccc1)[C@H]1CC(=O)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C21H19NO4/c1-14(23)19(20(25)16-10-6-3-7-11-16)17-12-18(24)22(21(17)26)13-15-8-4-2-5-9-15/h2-11,17,19H,12-13H2,1H3/t17-,19?/m1/s1 |
| InChIKey | SZRIPRVPLJBBOT-DUSLRRAJSA-N |
| XLogP | 2.65 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|