C16H16ClNO5 — CID 139260088
methyl 3-(4-chlorophenyl)-2-[(3R)-1-ethyl-2,5-dioxopyrrolidin-3-yl]-3-oxopropanoate (PubChem CID 139260088) has the molecular formula C16H16ClNO5 and a molecular weight of 337.76 g/mol. Its IUPAC name is methyl 3-(4-chlorophenyl)-2-[(3R)-1-ethyl-2,5-dioxopyrrolidin-3-yl]-3-oxopropanoate.
| Compound Name | methyl 3-(4-chlorophenyl)-2-[(3R)-1-ethyl-2,5-dioxopyrrolidin-3-yl]-3-oxopropanoate |
|---|---|
| PubChem CID | 139260088 |
| Molecular Formula | C16H16ClNO5 |
| Molecular Weight | 337.76 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | methyl 3-(4-chlorophenyl)-2-[(3R)-1-ethyl-2,5-dioxopyrrolidin-3-yl]-3-oxopropanoate |
| SMILES | CCN1C(=O)C[C@H](C(C(=O)OC)C(=O)c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C16H16ClNO5/c1-3-18-12(19)8-11(15(18)21)13(16(22)23-2)14(20)9-4-6-10(17)7-5-9/h4-7,11,13H,3,8H2,1-2H3/t11-,13?/m1/s1 |
| InChIKey | KBVBWOQGXUZIJI-JTDNENJMSA-N |
| XLogP | 1.71 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.76 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|