C21H24FNO5 — CID 139260129
ethyl (2S)-2-[(3S)-1-cyclohexyl-2,5-dioxopyrrolidin-3-yl]-2-fluoro-3-oxo-3-phenylpropanoate (PubChem CID 139260129) has the molecular formula C21H24FNO5 and a molecular weight of 389.42 g/mol. Its IUPAC name is ethyl (2S)-2-[(3S)-1-cyclohexyl-2,5-dioxopyrrolidin-3-yl]-2-fluoro-3-oxo-3-phenylpropanoate.
| Compound Name | ethyl (2S)-2-[(3S)-1-cyclohexyl-2,5-dioxopyrrolidin-3-yl]-2-fluoro-3-oxo-3-phenylpropanoate |
|---|---|
| PubChem CID | 139260129 |
| Molecular Formula | C21H24FNO5 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | ethyl (2S)-2-[(3S)-1-cyclohexyl-2,5-dioxopyrrolidin-3-yl]-2-fluoro-3-oxo-3-phenylpropanoate |
| SMILES | CCOC(=O)[C@@](F)(C(=O)c1ccccc1)[C@H]1CC(=O)N(C2CCCCC2)C1=O |
| InChI | InChI=1S/C21H24FNO5/c1-2-28-20(27)21(22,18(25)14-9-5-3-6-10-14)16-13-17(24)23(19(16)26)15-11-7-4-8-12-15/h3,5-6,9-10,15-16H,2,4,7-8,11-13H2,1H3/t16-,21-/m0/s1 |
| InChIKey | ULBFCHGRRCPROO-KKSFZXQISA-N |
| XLogP | 2.85 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|