C28H30FNO7 — CID 135031558
diethyl 2-[4-(1,3-dioxoisoindol-2-yl)-7-(4-fluorophenyl)-7-oxoheptyl]propanedioate (PubChem CID 135031558) has the molecular formula C28H30FNO7 and a molecular weight of 511.55 g/mol. Its IUPAC name is diethyl 2-[4-(1,3-dioxoisoindol-2-yl)-7-(4-fluorophenyl)-7-oxoheptyl]propanedioate.
| Compound Name | diethyl 2-[4-(1,3-dioxoisoindol-2-yl)-7-(4-fluorophenyl)-7-oxoheptyl]propanedioate |
|---|---|
| PubChem CID | 135031558 |
| Molecular Formula | C28H30FNO7 |
| Molecular Weight | 511.55 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | diethyl 2-[4-(1,3-dioxoisoindol-2-yl)-7-(4-fluorophenyl)-7-oxoheptyl]propanedioate |
| SMILES | CCOC(=O)C(CCCC(CCC(=O)c1ccc(F)cc1)N1C(=O)c2ccccc2C1=O)C(=O)OCC |
| InChI | InChI=1S/C28H30FNO7/c1-3-36-27(34)23(28(35)37-4-2)11-7-8-20(16-17-24(31)18-12-14-19(29)15-13-18)30-25(32)21-9-5-6-10-22(21)26(30)33/h5-6,9-10,12-15,20,23H,3-4,7-8,11,16-17H2,1-2H3 |
| InChIKey | UCFPQIYMYAFZBU-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.55 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|