C24H30FNO7 — CID 134846219
trans-diethyl (2S,3R)-2-[(4S)-5,5-dimethyl-2-oxo-4-propan-2-yl-1,3-oxazolidine-3-carbonyl]-2-fluoro-3-phenylcyclopropane-1,1-dicarboxylate (PubChem CID 134846219) has the molecular formula C24H30FNO7 and a molecular weight of 463.50 g/mol. Its IUPAC name is trans-diethyl (2S,3R)-2-[(4S)-5,5-dimethyl-2-oxo-4-propan-2-yl-1,3-oxazolidine-3-carbonyl]-2-fluoro-3-phenylcyclopropane-1,1-dicarboxylate.
| Compound Name | trans-diethyl (2S,3R)-2-[(4S)-5,5-dimethyl-2-oxo-4-propan-2-yl-1,3-oxazolidine-3-carbonyl]-2-fluoro-3-phenylcyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 134846219 |
| Molecular Formula | C24H30FNO7 |
| Molecular Weight | 463.50 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | trans-diethyl (2S,3R)-2-[(4S)-5,5-dimethyl-2-oxo-4-propan-2-yl-1,3-oxazolidine-3-carbonyl]-2-fluoro-3-phenylcyclopropane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)[C@@H](c2ccccc2)[C@@]1(F)C(=O)N1C(=O)OC(C)(C)[C@@H]1C(C)C |
| InChI | InChI=1S/C24H30FNO7/c1-7-31-19(28)23(20(29)32-8-2)16(15-12-10-9-11-13-15)24(23,25)18(27)26-17(14(3)4)22(5,6)33-21(26)30/h9-14,16-17H,7-8H2,1-6H3/t16-,17+,24-/m1/s1 |
| InChIKey | GHTHKMIYZHOULT-XVTZWQNCSA-N |
| XLogP | 3.39 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.50 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|