C20H24FNO6 — CID 134846223
cis-diethyl (2R,3R)-2-fluoro-2-(morpholine-4-carbonyl)-3-phenylcyclopropane-1,1-dicarboxylate (PubChem CID 134846223) has the molecular formula C20H24FNO6 and a molecular weight of 393.41 g/mol. Its IUPAC name is cis-diethyl (2R,3R)-2-fluoro-2-(morpholine-4-carbonyl)-3-phenylcyclopropane-1,1-dicarboxylate.
| Compound Name | cis-diethyl (2R,3R)-2-fluoro-2-(morpholine-4-carbonyl)-3-phenylcyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 134846223 |
| Molecular Formula | C20H24FNO6 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | cis-diethyl (2R,3R)-2-fluoro-2-(morpholine-4-carbonyl)-3-phenylcyclopropane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)[C@@H](c2ccccc2)[C@]1(F)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C20H24FNO6/c1-3-27-17(24)19(18(25)28-4-2)15(14-8-6-5-7-9-14)20(19,21)16(23)22-10-12-26-13-11-22/h5-9,15H,3-4,10-13H2,1-2H3/t15-,20+/m1/s1 |
| InChIKey | JWLZLVDKUPTGKZ-QRWLVFNGSA-N |
| XLogP | 1.46 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|