C19H22FNO5 — CID 139260127
ethyl (2S)-2-[(3S)-1-tert-butyl-2,5-dioxopyrrolidin-3-yl]-2-fluoro-3-oxo-3-phenylpropanoate (PubChem CID 139260127) has the molecular formula C19H22FNO5 and a molecular weight of 363.39 g/mol. Its IUPAC name is ethyl (2S)-2-[(3S)-1-tert-butyl-2,5-dioxopyrrolidin-3-yl]-2-fluoro-3-oxo-3-phenylpropanoate.
| Compound Name | ethyl (2S)-2-[(3S)-1-tert-butyl-2,5-dioxopyrrolidin-3-yl]-2-fluoro-3-oxo-3-phenylpropanoate |
|---|---|
| PubChem CID | 139260127 |
| Molecular Formula | C19H22FNO5 |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | ethyl (2S)-2-[(3S)-1-tert-butyl-2,5-dioxopyrrolidin-3-yl]-2-fluoro-3-oxo-3-phenylpropanoate |
| SMILES | CCOC(=O)[C@@](F)(C(=O)c1ccccc1)[C@H]1CC(=O)N(C(C)(C)C)C1=O |
| InChI | InChI=1S/C19H22FNO5/c1-5-26-17(25)19(20,15(23)12-9-7-6-8-10-12)13-11-14(22)21(16(13)24)18(2,3)4/h6-10,13H,5,11H2,1-4H3/t13-,19-/m0/s1 |
| InChIKey | WJPYUZXZJIVEFZ-DJJJIMSYSA-N |
| XLogP | 2.31 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|