C18H17F4NO5 — CID 139260138
ethyl (2S)-2-[(3S)-1-ethyl-2,5-dioxopyrrolidin-3-yl]-2-fluoro-3-oxo-3-[4-(trifluoromethyl)phenyl]propanoate (PubChem CID 139260138) has the molecular formula C18H17F4NO5 and a molecular weight of 403.33 g/mol. Its IUPAC name is ethyl (2S)-2-[(3S)-1-ethyl-2,5-dioxopyrrolidin-3-yl]-2-fluoro-3-oxo-3-[4-(trifluoromethyl)phenyl]propanoate.
| Compound Name | ethyl (2S)-2-[(3S)-1-ethyl-2,5-dioxopyrrolidin-3-yl]-2-fluoro-3-oxo-3-[4-(trifluoromethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 139260138 |
| Molecular Formula | C18H17F4NO5 |
| Molecular Weight | 403.33 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | ethyl (2S)-2-[(3S)-1-ethyl-2,5-dioxopyrrolidin-3-yl]-2-fluoro-3-oxo-3-[4-(trifluoromethyl)phenyl]propanoate |
| SMILES | CCOC(=O)[C@@](F)(C(=O)c1ccc(C(F)(F)F)cc1)[C@H]1CC(=O)N(CC)C1=O |
| InChI | InChI=1S/C18H17F4NO5/c1-3-23-13(24)9-12(15(23)26)17(19,16(27)28-4-2)14(25)10-5-7-11(8-6-10)18(20,21)22/h5-8,12H,3-4,9H2,1-2H3/t12-,17-/m0/s1 |
| InChIKey | CKFHJKBMZXCCIE-SJCJKPOMSA-N |
| XLogP | 2.55 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|