C20H21F4NO5 — CID 139260139
ethyl (2S)-2-[(3S)-1-tert-butyl-2,5-dioxopyrrolidin-3-yl]-2-fluoro-3-oxo-3-[4-(trifluoromethyl)phenyl]propanoate (PubChem CID 139260139) has the molecular formula C20H21F4NO5 and a molecular weight of 431.38 g/mol. Its IUPAC name is ethyl (2S)-2-[(3S)-1-tert-butyl-2,5-dioxopyrrolidin-3-yl]-2-fluoro-3-oxo-3-[4-(trifluoromethyl)phenyl]propanoate.
| Compound Name | ethyl (2S)-2-[(3S)-1-tert-butyl-2,5-dioxopyrrolidin-3-yl]-2-fluoro-3-oxo-3-[4-(trifluoromethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 139260139 |
| Molecular Formula | C20H21F4NO5 |
| Molecular Weight | 431.38 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | ethyl (2S)-2-[(3S)-1-tert-butyl-2,5-dioxopyrrolidin-3-yl]-2-fluoro-3-oxo-3-[4-(trifluoromethyl)phenyl]propanoate |
| SMILES | CCOC(=O)[C@@](F)(C(=O)c1ccc(C(F)(F)F)cc1)[C@H]1CC(=O)N(C(C)(C)C)C1=O |
| InChI | InChI=1S/C20H21F4NO5/c1-5-30-17(29)19(21,13-10-14(26)25(16(13)28)18(2,3)4)15(27)11-6-8-12(9-7-11)20(22,23)24/h6-9,13H,5,10H2,1-4H3/t13-,19-/m0/s1 |
| InChIKey | WWNKNHKOZSIIMQ-DJJJIMSYSA-N |
| XLogP | 3.33 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.38 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|