C22H20FNO5 — CID 139260125
ethyl (2S)-2-[(3S)-1-benzyl-2,5-dioxopyrrolidin-3-yl]-2-fluoro-3-oxo-3-phenylpropanoate (PubChem CID 139260125) has the molecular formula C22H20FNO5 and a molecular weight of 397.40 g/mol. Its IUPAC name is ethyl (2S)-2-[(3S)-1-benzyl-2,5-dioxopyrrolidin-3-yl]-2-fluoro-3-oxo-3-phenylpropanoate.
| Compound Name | ethyl (2S)-2-[(3S)-1-benzyl-2,5-dioxopyrrolidin-3-yl]-2-fluoro-3-oxo-3-phenylpropanoate |
|---|---|
| PubChem CID | 139260125 |
| Molecular Formula | C22H20FNO5 |
| Molecular Weight | 397.40 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | ethyl (2S)-2-[(3S)-1-benzyl-2,5-dioxopyrrolidin-3-yl]-2-fluoro-3-oxo-3-phenylpropanoate |
| SMILES | CCOC(=O)[C@@](F)(C(=O)c1ccccc1)[C@H]1CC(=O)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C22H20FNO5/c1-2-29-21(28)22(23,19(26)16-11-7-4-8-12-16)17-13-18(25)24(20(17)27)14-15-9-5-3-6-10-15/h3-12,17H,2,13-14H2,1H3/t17-,22-/m0/s1 |
| InChIKey | FCIDUWBPLRRIPE-JTSKRJEESA-N |
| XLogP | 2.72 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.40 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|