C17H15F4NO5 — CID 139260136
ethyl (2S)-2-fluoro-2-[(3S)-1-methyl-2,5-dioxopyrrolidin-3-yl]-3-oxo-3-[4-(trifluoromethyl)phenyl]propanoate (PubChem CID 139260136) has the molecular formula C17H15F4NO5 and a molecular weight of 389.30 g/mol. Its IUPAC name is ethyl (2S)-2-fluoro-2-[(3S)-1-methyl-2,5-dioxopyrrolidin-3-yl]-3-oxo-3-[4-(trifluoromethyl)phenyl]propanoate.
| Compound Name | ethyl (2S)-2-fluoro-2-[(3S)-1-methyl-2,5-dioxopyrrolidin-3-yl]-3-oxo-3-[4-(trifluoromethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 139260136 |
| Molecular Formula | C17H15F4NO5 |
| Molecular Weight | 389.30 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | ethyl (2S)-2-fluoro-2-[(3S)-1-methyl-2,5-dioxopyrrolidin-3-yl]-3-oxo-3-[4-(trifluoromethyl)phenyl]propanoate |
| SMILES | CCOC(=O)[C@@](F)(C(=O)c1ccc(C(F)(F)F)cc1)[C@H]1CC(=O)N(C)C1=O |
| InChI | InChI=1S/C17H15F4NO5/c1-3-27-15(26)16(18,11-8-12(23)22(2)14(11)25)13(24)9-4-6-10(7-5-9)17(19,20)21/h4-7,11H,3,8H2,1-2H3/t11-,16-/m0/s1 |
| InChIKey | OKJXDORLWFJVFS-ZBEGNZNMSA-N |
| XLogP | 2.16 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.30 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|