About N-[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]-N-oxidohexanamide
N-[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]-N-oxidohexanamide (PubChem CID 2025093) has the molecular formula C16H19N2O4-
and a molecular weight of 303.34 g/mol. Its IUPAC name is N-[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]-N-oxidohexanamide.
Molecular Properties
| Compound Name | N-[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]-N-oxidohexanamide |
| PubChem CID | 2025093 |
| Molecular Formula | C16H19N2O4- |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | N-[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]-N-oxidohexanamide |
| SMILES | CCCCCC(=O)N([O-])[C@H]1CC(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C16H19N2O4/c1-2-3-5-10-14(19)18(22)13-11-15(20)17(16(13)21)12-8-6-4-7-9-12/h4,6-9,13H,2-3,5,10-11H2,1H3/q-1/t13-/m0/s1 |
| InChIKey | DQMPBLPBFQYXTB-ZDUSSCGKSA-N |
| XLogP | 2.23 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]-N-oxidohexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]-N-oxidohexanamide?
The IUPAC name of N-[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]-N-oxidohexanamide (CID 2025093) is N-[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]-N-oxidohexanamide.
What is the SMILES notation for N-[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]-N-oxidohexanamide?
The canonical SMILES for N-[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]-N-oxidohexanamide is CCCCCC(=O)N([O-])[C@H]1CC(=O)N(c2ccccc2)C1=O.
What is the InChIKey of N-[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]-N-oxidohexanamide?
The InChIKey is DQMPBLPBFQYXTB-ZDUSSCGKSA-N. The full InChI is InChI=1S/C16H19N2O4/c1-2-3-5-10-14(19)18(22)13-11-15(20)17(16(13)21)12-8-6-4-7-9-12/h4,6-9,13H,2-3,5,10-11H2,1H3/q-1/t13-/m0/s1.
What are the key properties of N-[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]-N-oxidohexanamide?
N-[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]-N-oxidohexanamide has a molecular weight of 303.34 g/mol, XLogP of 2.23, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]-N-oxidohexanamide is sourced from PubChem (CID 2025093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).