C21H24N2O4 — CID 662103
3-(N-hydroxyanilino)-1-(4-pentoxyphenyl)pyrrolidine-2,5-dione (PubChem CID 662103) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is 3-(N-hydroxyanilino)-1-(4-pentoxyphenyl)pyrrolidine-2,5-dione.
| Compound Name | 3-(N-hydroxyanilino)-1-(4-pentoxyphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 662103 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 3-(N-hydroxyanilino)-1-(4-pentoxyphenyl)pyrrolidine-2,5-dione |
| SMILES | CCCCCOc1ccc(N2C(=O)CC(N(O)c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C21H24N2O4/c1-2-3-7-14-27-18-12-10-16(11-13-18)22-20(24)15-19(21(22)25)23(26)17-8-5-4-6-9-17/h4-6,8-13,19,26H,2-3,7,14-15H2,1H3 |
| InChIKey | GCIUIOZZUGWXQK-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|