C28H31N3O4S — CID 51445722
1-(furan-2-ylmethyl)-1-[(3S)-1-(4-hexoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-3-phenylthiourea (PubChem CID 51445722) has the molecular formula C28H31N3O4S and a molecular weight of 505.64 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-1-[(3S)-1-(4-hexoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-3-phenylthiourea.
| Compound Name | 1-(furan-2-ylmethyl)-1-[(3S)-1-(4-hexoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-3-phenylthiourea |
|---|---|
| PubChem CID | 51445722 |
| Molecular Formula | C28H31N3O4S |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | 1-(furan-2-ylmethyl)-1-[(3S)-1-(4-hexoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-3-phenylthiourea |
| SMILES | CCCCCCOc1ccc(N2C(=O)C[C@H](N(Cc3ccco3)C(=S)Nc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C28H31N3O4S/c1-2-3-4-8-17-34-23-15-13-22(14-16-23)31-26(32)19-25(27(31)33)30(20-24-12-9-18-35-24)28(36)29-21-10-6-5-7-11-21/h5-7,9-16,18,25H,2-4,8,17,19-20H2,1H3,(H,29,36)/t25-/m0/s1 |
| InChIKey | CCJQPXVUXRWGRV-VWLOTQADSA-N |
| XLogP | 5.77 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|