C26H33N3O4S — CID 5140651
1-[1-(4-hexoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-1-[(4-methoxyphenyl)methyl]-3-methylthiourea (PubChem CID 5140651) has the molecular formula C26H33N3O4S and a molecular weight of 483.63 g/mol. Its IUPAC name is 1-[1-(4-hexoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-1-[(4-methoxyphenyl)methyl]-3-methylthiourea.
| Compound Name | 1-[1-(4-hexoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-1-[(4-methoxyphenyl)methyl]-3-methylthiourea |
|---|---|
| PubChem CID | 5140651 |
| Molecular Formula | C26H33N3O4S |
| Molecular Weight | 483.63 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | 1-[1-(4-hexoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-1-[(4-methoxyphenyl)methyl]-3-methylthiourea |
| SMILES | CCCCCCOc1ccc(N2C(=O)CC(N(Cc3ccc(OC)cc3)C(=S)NC)C2=O)cc1 |
| InChI | InChI=1S/C26H33N3O4S/c1-4-5-6-7-16-33-22-14-10-20(11-15-22)29-24(30)17-23(25(29)31)28(26(34)27-2)18-19-8-12-21(32-3)13-9-19/h8-15,23H,4-7,16-18H2,1-3H3,(H,27,34) |
| InChIKey | RREWUCUUGURDEY-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.63 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|