C17H17N3O3S — CID 2869060
1-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-1-(furan-2-ylmethyl)-3-methylthiourea (PubChem CID 2869060) has the molecular formula C17H17N3O3S and a molecular weight of 343.41 g/mol. Its IUPAC name is 1-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-1-(furan-2-ylmethyl)-3-methylthiourea.
| Compound Name | 1-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-1-(furan-2-ylmethyl)-3-methylthiourea |
|---|---|
| PubChem CID | 2869060 |
| Molecular Formula | C17H17N3O3S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 1-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-1-(furan-2-ylmethyl)-3-methylthiourea |
| SMILES | CNC(=S)N(Cc1ccco1)C1CC(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C17H17N3O3S/c1-18-17(24)19(11-13-8-5-9-23-13)14-10-15(21)20(16(14)22)12-6-3-2-4-7-12/h2-9,14H,10-11H2,1H3,(H,18,24) |
| InChIKey | JRQFSJNABYZQGQ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|