C22H16FIN2O4 — CID 23832287
2-fluoro-N-(furan-2-ylmethyl)-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]benzamide (PubChem CID 23832287) has the molecular formula C22H16FIN2O4 and a molecular weight of 518.28 g/mol. Its IUPAC name is 2-fluoro-N-(furan-2-ylmethyl)-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]benzamide.
| Compound Name | 2-fluoro-N-(furan-2-ylmethyl)-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 23832287 |
| Molecular Formula | C22H16FIN2O4 |
| Molecular Weight | 518.28 g/mol |
| Exact Mass | 518.01 |
| IUPAC Name | 2-fluoro-N-(furan-2-ylmethyl)-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]benzamide |
| SMILES | O=C1CC(N(Cc2ccco2)C(=O)c2ccccc2F)C(=O)N1c1ccc(I)cc1 |
| InChI | InChI=1S/C22H16FIN2O4/c23-18-6-2-1-5-17(18)21(28)25(13-16-4-3-11-30-16)19-12-20(27)26(22(19)29)15-9-7-14(24)8-10-15/h1-11,19H,12-13H2 |
| InChIKey | WDCOGIWAXBSIRP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.28 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|