C21H23IN2O4 — CID 23915182
N-(furan-2-ylmethyl)-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-3,3-dimethylbutanamide (PubChem CID 23915182) has the molecular formula C21H23IN2O4 and a molecular weight of 494.33 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-3,3-dimethylbutanamide.
| Compound Name | N-(furan-2-ylmethyl)-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 23915182 |
| Molecular Formula | C21H23IN2O4 |
| Molecular Weight | 494.33 g/mol |
| Exact Mass | 494.07 |
| IUPAC Name | N-(furan-2-ylmethyl)-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)CC(=O)N(Cc1ccco1)C1CC(=O)N(c2ccc(I)cc2)C1=O |
| InChI | InChI=1S/C21H23IN2O4/c1-21(2,3)12-19(26)23(13-16-5-4-10-28-16)17-11-18(25)24(20(17)27)15-8-6-14(22)7-9-15/h4-10,17H,11-13H2,1-3H3 |
| InChIKey | OELSJPNCQKIJSI-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.33 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|