C22H27N2O3+ — CID 2273222
[(3S)-1-(4-butoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-(2-phenylethyl)azanium (PubChem CID 2273222) has the molecular formula C22H27N2O3+ and a molecular weight of 367.47 g/mol. Its IUPAC name is [(3S)-1-(4-butoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-(2-phenylethyl)azanium.
| Compound Name | [(3S)-1-(4-butoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-(2-phenylethyl)azanium |
|---|---|
| PubChem CID | 2273222 |
| Molecular Formula | C22H27N2O3+ |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | [(3S)-1-(4-butoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-(2-phenylethyl)azanium |
| SMILES | CCCCOc1ccc(N2C(=O)C[C@H]([NH2+]CCc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C22H26N2O3/c1-2-3-15-27-19-11-9-18(10-12-19)24-21(25)16-20(22(24)26)23-14-13-17-7-5-4-6-8-17/h4-12,20,23H,2-3,13-16H2,1H3/p+1/t20-/m0/s1 |
| InChIKey | YVFDPNZYHNBBRX-FQEVSTJZSA-O |
| XLogP | 2.30 |
| TPSA | 63.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|