C15H20N3O4+ — CID 7034592
(2-amino-2-oxoethyl)-[(3R)-2,5-dioxo-1-(4-propoxyphenyl)pyrrolidin-3-yl]azanium (PubChem CID 7034592) has the molecular formula C15H20N3O4+ and a molecular weight of 306.34 g/mol. Its IUPAC name is (2-amino-2-oxoethyl)-[(3R)-2,5-dioxo-1-(4-propoxyphenyl)pyrrolidin-3-yl]azanium.
| Compound Name | (2-amino-2-oxoethyl)-[(3R)-2,5-dioxo-1-(4-propoxyphenyl)pyrrolidin-3-yl]azanium |
|---|---|
| PubChem CID | 7034592 |
| Molecular Formula | C15H20N3O4+ |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | (2-amino-2-oxoethyl)-[(3R)-2,5-dioxo-1-(4-propoxyphenyl)pyrrolidin-3-yl]azanium |
| SMILES | CCCOc1ccc(N2C(=O)C[C@@H]([NH2+]CC(N)=O)C2=O)cc1 |
| InChI | InChI=1S/C15H19N3O4/c1-2-7-22-11-5-3-10(4-6-11)18-14(20)8-12(15(18)21)17-9-13(16)19/h3-6,12,17H,2,7-9H2,1H3,(H2,16,19)/p+1/t12-/m1/s1 |
| InChIKey | AHXZPLHXOUTBGV-GFCCVEGCSA-O |
| XLogP | -0.84 |
| TPSA | 106.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|