C13H14ClN2O4+ — CID 4073531
[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-(2-methoxy-2-oxoethyl)azanium (PubChem CID 4073531) has the molecular formula C13H14ClN2O4+ and a molecular weight of 297.72 g/mol. Its IUPAC name is [1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-(2-methoxy-2-oxoethyl)azanium.
| Compound Name | [1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-(2-methoxy-2-oxoethyl)azanium |
|---|---|
| PubChem CID | 4073531 |
| Molecular Formula | C13H14ClN2O4+ |
| Molecular Weight | 297.72 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | [1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-(2-methoxy-2-oxoethyl)azanium |
| SMILES | COC(=O)C[NH2+]C1CC(=O)N(c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C13H13ClN2O4/c1-20-12(18)7-15-10-6-11(17)16(13(10)19)9-4-2-8(14)3-5-9/h2-5,10,15H,6-7H2,1H3/p+1 |
| InChIKey | FQTIOWHXHMZKNP-UHFFFAOYSA-O |
| XLogP | -0.29 |
| TPSA | 80.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.72 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|