C18H18ClN2O2+ — CID 4993829
2-(4-chlorophenyl)ethyl-(2,5-dioxo-1-phenylpyrrolidin-3-yl)azanium (PubChem CID 4993829) has the molecular formula C18H18ClN2O2+ and a molecular weight of 329.81 g/mol. Its IUPAC name is 2-(4-chlorophenyl)ethyl-(2,5-dioxo-1-phenylpyrrolidin-3-yl)azanium.
| Compound Name | 2-(4-chlorophenyl)ethyl-(2,5-dioxo-1-phenylpyrrolidin-3-yl)azanium |
|---|---|
| PubChem CID | 4993829 |
| Molecular Formula | C18H18ClN2O2+ |
| Molecular Weight | 329.81 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 2-(4-chlorophenyl)ethyl-(2,5-dioxo-1-phenylpyrrolidin-3-yl)azanium |
| SMILES | O=C1CC([NH2+]CCc2ccc(Cl)cc2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C18H17ClN2O2/c19-14-8-6-13(7-9-14)10-11-20-16-12-17(22)21(18(16)23)15-4-2-1-3-5-15/h1-9,16,20H,10-12H2/p+1 |
| InChIKey | QQPSIMCQRQXJSW-UHFFFAOYSA-O |
| XLogP | 1.78 |
| TPSA | 53.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.81 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|