C18H19N2O3+ — CID 4068669
(2,5-dioxo-1-phenylpyrrolidin-3-yl)-[(4-methoxyphenyl)methyl]azanium (PubChem CID 4068669) has the molecular formula C18H19N2O3+ and a molecular weight of 311.36 g/mol. Its IUPAC name is (2,5-dioxo-1-phenylpyrrolidin-3-yl)-[(4-methoxyphenyl)methyl]azanium.
| Compound Name | (2,5-dioxo-1-phenylpyrrolidin-3-yl)-[(4-methoxyphenyl)methyl]azanium |
|---|---|
| PubChem CID | 4068669 |
| Molecular Formula | C18H19N2O3+ |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | (2,5-dioxo-1-phenylpyrrolidin-3-yl)-[(4-methoxyphenyl)methyl]azanium |
| SMILES | COc1ccc(C[NH2+]C2CC(=O)N(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C18H18N2O3/c1-23-15-9-7-13(8-10-15)12-19-16-11-17(21)20(18(16)22)14-5-3-2-4-6-14/h2-10,16,19H,11-12H2,1H3/p+1 |
| InChIKey | KBCFFMDJDDBDJN-UHFFFAOYSA-O |
| XLogP | 1.09 |
| TPSA | 63.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|