C18H20N3O5S+ — CID 6968722
[(3S)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-[(4-sulfamoylphenyl)methyl]azanium (PubChem CID 6968722) has the molecular formula C18H20N3O5S+ and a molecular weight of 390.44 g/mol. Its IUPAC name is [(3S)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-[(4-sulfamoylphenyl)methyl]azanium.
| Compound Name | [(3S)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-[(4-sulfamoylphenyl)methyl]azanium |
|---|---|
| PubChem CID | 6968722 |
| Molecular Formula | C18H20N3O5S+ |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | [(3S)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-[(4-sulfamoylphenyl)methyl]azanium |
| SMILES | COc1ccc(N2C(=O)C[C@H]([NH2+]Cc3ccc(S(N)(=O)=O)cc3)C2=O)cc1 |
| InChI | InChI=1S/C18H19N3O5S/c1-26-14-6-4-13(5-7-14)21-17(22)10-16(18(21)23)20-11-12-2-8-15(9-3-12)27(19,24)25/h2-9,16,20H,10-11H2,1H3,(H2,19,24,25)/p+1/t16-/m0/s1 |
| InChIKey | NTJIUANECCEGKP-INIZCTEOSA-O |
| XLogP | -0.26 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|