C23H31N2O4+ — CID 7122568
2-(1-adamantyloxy)ethyl-[(3R)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]azanium (PubChem CID 7122568) has the molecular formula C23H31N2O4+ and a molecular weight of 399.51 g/mol. Its IUPAC name is 2-(1-adamantyloxy)ethyl-[(3R)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]azanium.
| Compound Name | 2-(1-adamantyloxy)ethyl-[(3R)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]azanium |
|---|---|
| PubChem CID | 7122568 |
| Molecular Formula | C23H31N2O4+ |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | 2-(1-adamantyloxy)ethyl-[(3R)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]azanium |
| SMILES | COc1ccc(N2C(=O)C[C@@H]([NH2+]CCOC34CC5CC(CC(C5)C3)C4)C2=O)cc1 |
| InChI | InChI=1S/C23H30N2O4/c1-28-19-4-2-18(3-5-19)25-21(26)11-20(22(25)27)24-6-7-29-23-12-15-8-16(13-23)10-17(9-15)14-23/h2-5,15-17,20,24H,6-14H2,1H3/p+1/t15?,16?,17?,20-,23?/m1/s1 |
| InChIKey | UUZFEIBXGQTRAZ-LZGZYFLISA-O |
| XLogP | 1.88 |
| TPSA | 72.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|