C18H17Cl2N2O3+ — CID 7279556
(3,4-dichlorophenyl)methyl-[(3S)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]azanium (PubChem CID 7279556) has the molecular formula C18H17Cl2N2O3+ and a molecular weight of 380.25 g/mol. Its IUPAC name is (3,4-dichlorophenyl)methyl-[(3S)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]azanium.
| Compound Name | (3,4-dichlorophenyl)methyl-[(3S)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]azanium |
|---|---|
| PubChem CID | 7279556 |
| Molecular Formula | C18H17Cl2N2O3+ |
| Molecular Weight | 380.25 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | (3,4-dichlorophenyl)methyl-[(3S)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]azanium |
| SMILES | COc1ccc(N2C(=O)C[C@H]([NH2+]Cc3ccc(Cl)c(Cl)c3)C2=O)cc1 |
| InChI | InChI=1S/C18H16Cl2N2O3/c1-25-13-5-3-12(4-6-13)22-17(23)9-16(18(22)24)21-10-11-2-7-14(19)15(20)8-11/h2-8,16,21H,9-10H2,1H3/p+1/t16-/m0/s1 |
| InChIKey | NOUPGNCARZBGRF-INIZCTEOSA-O |
| XLogP | 2.40 |
| TPSA | 63.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.25 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|