C19H19Cl2N2O3+ — CID 7279544
(2,4-dichlorophenyl)methyl-[(3R)-1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]azanium (PubChem CID 7279544) has the molecular formula C19H19Cl2N2O3+ and a molecular weight of 394.28 g/mol. Its IUPAC name is (2,4-dichlorophenyl)methyl-[(3R)-1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]azanium.
| Compound Name | (2,4-dichlorophenyl)methyl-[(3R)-1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]azanium |
|---|---|
| PubChem CID | 7279544 |
| Molecular Formula | C19H19Cl2N2O3+ |
| Molecular Weight | 394.28 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | (2,4-dichlorophenyl)methyl-[(3R)-1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]azanium |
| SMILES | CCOc1ccc(N2C(=O)C[C@@H]([NH2+]Cc3ccc(Cl)cc3Cl)C2=O)cc1 |
| InChI | InChI=1S/C19H18Cl2N2O3/c1-2-26-15-7-5-14(6-8-15)23-18(24)10-17(19(23)25)22-11-12-3-4-13(20)9-16(12)21/h3-9,17,22H,2,10-11H2,1H3/p+1/t17-/m1/s1 |
| InChIKey | HYRXACQMPVKSCO-QGZVFWFLSA-O |
| XLogP | 2.79 |
| TPSA | 63.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.28 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|