C18H21N2O3S+ — CID 7057836
[(3S)-1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-(2-thiophen-2-ylethyl)azanium (PubChem CID 7057836) has the molecular formula C18H21N2O3S+ and a molecular weight of 345.44 g/mol. Its IUPAC name is [(3S)-1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-(2-thiophen-2-ylethyl)azanium.
| Compound Name | [(3S)-1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-(2-thiophen-2-ylethyl)azanium |
|---|---|
| PubChem CID | 7057836 |
| Molecular Formula | C18H21N2O3S+ |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | [(3S)-1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-(2-thiophen-2-ylethyl)azanium |
| SMILES | CCOc1ccc(N2C(=O)C[C@H]([NH2+]CCc3cccs3)C2=O)cc1 |
| InChI | InChI=1S/C18H20N2O3S/c1-2-23-14-7-5-13(6-8-14)20-17(21)12-16(18(20)22)19-10-9-15-4-3-11-24-15/h3-8,11,16,19H,2,9-10,12H2,1H3/p+1/t16-/m0/s1 |
| InChIKey | QPXMXFBIRQANAK-INIZCTEOSA-O |
| XLogP | 1.58 |
| TPSA | 63.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|