C19H23N2O3S+ — CID 7057838
[(3S)-1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-[2-(3-methylthiophen-2-yl)ethyl]azanium (PubChem CID 7057838) has the molecular formula C19H23N2O3S+ and a molecular weight of 359.47 g/mol. Its IUPAC name is [(3S)-1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-[2-(3-methylthiophen-2-yl)ethyl]azanium.
| Compound Name | [(3S)-1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-[2-(3-methylthiophen-2-yl)ethyl]azanium |
|---|---|
| PubChem CID | 7057838 |
| Molecular Formula | C19H23N2O3S+ |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | [(3S)-1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-[2-(3-methylthiophen-2-yl)ethyl]azanium |
| SMILES | CCOc1ccc(N2C(=O)C[C@H]([NH2+]CCc3sccc3C)C2=O)cc1 |
| InChI | InChI=1S/C19H22N2O3S/c1-3-24-15-6-4-14(5-7-15)21-18(22)12-16(19(21)23)20-10-8-17-13(2)9-11-25-17/h4-7,9,11,16,20H,3,8,10,12H2,1-2H3/p+1/t16-/m0/s1 |
| InChIKey | NKRHHUBHLUNLQN-INIZCTEOSA-O |
| XLogP | 1.89 |
| TPSA | 63.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|