C15H19N2O5+ — CID 4090695
[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-(2-methoxy-2-oxoethyl)azanium (PubChem CID 4090695) has the molecular formula C15H19N2O5+ and a molecular weight of 307.33 g/mol. Its IUPAC name is [1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-(2-methoxy-2-oxoethyl)azanium.
| Compound Name | [1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-(2-methoxy-2-oxoethyl)azanium |
|---|---|
| PubChem CID | 4090695 |
| Molecular Formula | C15H19N2O5+ |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | [1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-(2-methoxy-2-oxoethyl)azanium |
| SMILES | CCOc1ccc(N2C(=O)CC([NH2+]CC(=O)OC)C2=O)cc1 |
| InChI | InChI=1S/C15H18N2O5/c1-3-22-11-6-4-10(5-7-11)17-13(18)8-12(15(17)20)16-9-14(19)21-2/h4-7,12,16H,3,8-9H2,1-2H3/p+1 |
| InChIKey | GUKWKFGUBWNPRM-UHFFFAOYSA-O |
| XLogP | -0.55 |
| TPSA | 89.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|