C19H20ClN2O4+ — CID 7317627
[(3R)-1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-[(3,4-dimethoxyphenyl)methyl]azanium (PubChem CID 7317627) has the molecular formula C19H20ClN2O4+ and a molecular weight of 375.83 g/mol. Its IUPAC name is [(3R)-1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-[(3,4-dimethoxyphenyl)methyl]azanium.
| Compound Name | [(3R)-1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-[(3,4-dimethoxyphenyl)methyl]azanium |
|---|---|
| PubChem CID | 7317627 |
| Molecular Formula | C19H20ClN2O4+ |
| Molecular Weight | 375.83 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | [(3R)-1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-[(3,4-dimethoxyphenyl)methyl]azanium |
| SMILES | COc1ccc(C[NH2+][C@@H]2CC(=O)N(c3ccc(Cl)cc3)C2=O)cc1OC |
| InChI | InChI=1S/C19H19ClN2O4/c1-25-16-8-3-12(9-17(16)26-2)11-21-15-10-18(23)22(19(15)24)14-6-4-13(20)5-7-14/h3-9,15,21H,10-11H2,1-2H3/p+1/t15-/m1/s1 |
| InChIKey | KUMRUOZHUOQVAJ-OAHLLOKOSA-O |
| XLogP | 1.75 |
| TPSA | 72.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.83 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|