C21H25N2O4+ — CID 7117747
2-(3,4-dimethoxyphenyl)ethyl-[(3S)-1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]azanium (PubChem CID 7117747) has the molecular formula C21H25N2O4+ and a molecular weight of 369.44 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)ethyl-[(3S)-1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]azanium.
| Compound Name | 2-(3,4-dimethoxyphenyl)ethyl-[(3S)-1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]azanium |
|---|---|
| PubChem CID | 7117747 |
| Molecular Formula | C21H25N2O4+ |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)ethyl-[(3S)-1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]azanium |
| SMILES | COc1ccc(CC[NH2+][C@H]2CC(=O)N(c3ccc(C)cc3)C2=O)cc1OC |
| InChI | InChI=1S/C21H24N2O4/c1-14-4-7-16(8-5-14)23-20(24)13-17(21(23)25)22-11-10-15-6-9-18(26-2)19(12-15)27-3/h4-9,12,17,22H,10-11,13H2,1-3H3/p+1/t17-/m0/s1 |
| InChIKey | ZYGBRNLERRAQPU-KRWDZBQOSA-O |
| XLogP | 1.45 |
| TPSA | 72.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|