C18H17Cl2N2O2+ — CID 7453507
[(3S)-1-(3,4-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]-(2-phenylethyl)azanium (PubChem CID 7453507) has the molecular formula C18H17Cl2N2O2+ and a molecular weight of 364.25 g/mol. Its IUPAC name is [(3S)-1-(3,4-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]-(2-phenylethyl)azanium.
| Compound Name | [(3S)-1-(3,4-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]-(2-phenylethyl)azanium |
|---|---|
| PubChem CID | 7453507 |
| Molecular Formula | C18H17Cl2N2O2+ |
| Molecular Weight | 364.25 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | [(3S)-1-(3,4-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]-(2-phenylethyl)azanium |
| SMILES | O=C1C[C@H]([NH2+]CCc2ccccc2)C(=O)N1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H16Cl2N2O2/c19-14-7-6-13(10-15(14)20)22-17(23)11-16(18(22)24)21-9-8-12-4-2-1-3-5-12/h1-7,10,16,21H,8-9,11H2/p+1/t16-/m0/s1 |
| InChIKey | KOMSPYIIJRSARA-INIZCTEOSA-O |
| XLogP | 2.43 |
| TPSA | 53.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.25 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|